C18H23F2N3O2S2 — CID 11919346
N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 11919346) has the molecular formula C18H23F2N3O2S2 and a molecular weight of 415.53 g/mol. Its IUPAC name is N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 11919346 |
| Molecular Formula | C18H23F2N3O2S2 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCN(C(=S)N[C@H]2C[C@H]3CC[C@@H]2C3)CC1 |
| InChI | InChI=1S/C18H23F2N3O2S2/c19-14-2-1-3-15(20)17(14)27(24,25)23-8-6-22(7-9-23)18(26)21-16-11-12-4-5-13(16)10-12/h1-3,12-13,16H,4-11H2,(H,21,26)/t12-,13+,16-/m0/s1 |
| InChIKey | ZTJBFIUDMPUOGE-ZENOOKHLSA-N |
| XLogP | 2.33 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|