C17H25N4S+ — CID 11919112
N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-pyridin-1-ium-2-ylpiperazine-1-carbothioamide (PubChem CID 11919112) has the molecular formula C17H25N4S+ and a molecular weight of 317.48 g/mol. Its IUPAC name is N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-pyridin-1-ium-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-pyridin-1-ium-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 11919112 |
| Molecular Formula | C17H25N4S+ |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-pyridin-1-ium-2-ylpiperazine-1-carbothioamide |
| SMILES | S=C(N[C@@H]1C[C@H]2CC[C@@H]1C2)N1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C17H24N4S/c22-17(19-15-12-13-4-5-14(15)11-13)21-9-7-20(8-10-21)16-3-1-2-6-18-16/h1-3,6,13-15H,4-5,7-12H2,(H,19,22)/p+1/t13-,14+,15+/m0/s1 |
| InChIKey | HZWFPODKYUZSGH-RRFJBIMHSA-O |
| XLogP | 1.69 |
| TPSA | 32.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|