C17H23N3O2S — CID 18558127
N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-(furan-2-carbonyl)piperazine-1-carbothioamide (PubChem CID 18558127) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-(furan-2-carbonyl)piperazine-1-carbothioamide.
| Compound Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-(furan-2-carbonyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 18558127 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-(furan-2-carbonyl)piperazine-1-carbothioamide |
| SMILES | O=C(c1ccco1)N1CCN(C(=S)N[C@@H]2C[C@@H]3CC[C@@H]2C3)CC1 |
| InChI | InChI=1S/C17H23N3O2S/c21-16(15-2-1-9-22-15)19-5-7-20(8-6-19)17(23)18-14-11-12-3-4-13(14)10-12/h1-2,9,12-14H,3-8,10-11H2,(H,18,23)/t12-,13-,14-/m1/s1 |
| InChIKey | QMVGBTHMAMOUMG-MGPQQGTHSA-N |
| XLogP | 2.10 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|