C20H27N3O3S2 — CID 18558133
4-(4-acetylphenyl)sulfonyl-N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide (PubChem CID 18558133) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 4-(4-acetylphenyl)sulfonyl-N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide.
| Compound Name | 4-(4-acetylphenyl)sulfonyl-N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 18558133 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-(4-acetylphenyl)sulfonyl-N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(C(=S)N[C@@H]3C[C@@H]4CC[C@@H]3C4)CC2)cc1 |
| InChI | InChI=1S/C20H27N3O3S2/c1-14(24)16-4-6-18(7-5-16)28(25,26)23-10-8-22(9-11-23)20(27)21-19-13-15-2-3-17(19)12-15/h4-7,15,17,19H,2-3,8-13H2,1H3,(H,21,27)/t15-,17-,19-/m1/s1 |
| InChIKey | YOGOWRXUTAJWOP-SZVBFZGTSA-N |
| XLogP | 2.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|