C17H25N3O3S2 — CID 8677210
4-(4-acetylphenyl)sulfonyl-N-butylpiperazine-1-carbothioamide (PubChem CID 8677210) has the molecular formula C17H25N3O3S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 4-(4-acetylphenyl)sulfonyl-N-butylpiperazine-1-carbothioamide.
| Compound Name | 4-(4-acetylphenyl)sulfonyl-N-butylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8677210 |
| Molecular Formula | C17H25N3O3S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-(4-acetylphenyl)sulfonyl-N-butylpiperazine-1-carbothioamide |
| SMILES | CCCCNC(=S)N1CCN(S(=O)(=O)c2ccc(C(C)=O)cc2)CC1 |
| InChI | InChI=1S/C17H25N3O3S2/c1-3-4-9-18-17(24)19-10-12-20(13-11-19)25(22,23)16-7-5-15(6-8-16)14(2)21/h5-8H,3-4,9-13H2,1-2H3,(H,18,24) |
| InChIKey | DXDWXYYZQIUXCU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|