C15H20F3N3O3S2 — CID 8676167
N-propyl-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbothioamide (PubChem CID 8676167) has the molecular formula C15H20F3N3O3S2 and a molecular weight of 411.47 g/mol. Its IUPAC name is N-propyl-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-propyl-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8676167 |
| Molecular Formula | C15H20F3N3O3S2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | N-propyl-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbothioamide |
| SMILES | CCCNC(=S)N1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H20F3N3O3S2/c1-2-7-19-14(25)20-8-10-21(11-9-20)26(22,23)13-5-3-12(4-6-13)24-15(16,17)18/h3-6H,2,7-11H2,1H3,(H,19,25) |
| InChIKey | YMNHHKGNXYQYHJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|