C18H29N3O3S2 — CID 8677531
4-(4-tert-butylphenyl)sulfonyl-N-(2-methoxyethyl)piperazine-1-carbothioamide (PubChem CID 8677531) has the molecular formula C18H29N3O3S2 and a molecular weight of 399.58 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)sulfonyl-N-(2-methoxyethyl)piperazine-1-carbothioamide.
| Compound Name | 4-(4-tert-butylphenyl)sulfonyl-N-(2-methoxyethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8677531 |
| Molecular Formula | C18H29N3O3S2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-(4-tert-butylphenyl)sulfonyl-N-(2-methoxyethyl)piperazine-1-carbothioamide |
| SMILES | COCCNC(=S)N1CCN(S(=O)(=O)c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C18H29N3O3S2/c1-18(2,3)15-5-7-16(8-6-15)26(22,23)21-12-10-20(11-13-21)17(25)19-9-14-24-4/h5-8H,9-14H2,1-4H3,(H,19,25) |
| InChIKey | PVSAUFWYCSXSNA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|