C19H29N3O4S2 — CID 8743486
methyl 6-[[4-(4-methylphenyl)sulfonylpiperazine-1-carbothioyl]amino]hexanoate (PubChem CID 8743486) has the molecular formula C19H29N3O4S2 and a molecular weight of 427.59 g/mol. Its IUPAC name is methyl 6-[[4-(4-methylphenyl)sulfonylpiperazine-1-carbothioyl]amino]hexanoate.
| Compound Name | methyl 6-[[4-(4-methylphenyl)sulfonylpiperazine-1-carbothioyl]amino]hexanoate |
|---|---|
| PubChem CID | 8743486 |
| Molecular Formula | C19H29N3O4S2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | methyl 6-[[4-(4-methylphenyl)sulfonylpiperazine-1-carbothioyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)N1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C19H29N3O4S2/c1-16-7-9-17(10-8-16)28(24,25)22-14-12-21(13-15-22)19(27)20-11-5-3-4-6-18(23)26-2/h7-10H,3-6,11-15H2,1-2H3,(H,20,27) |
| InChIKey | NVTQKCPUXOGMMR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|