C19H21Cl2N3O2S2 — CID 3680294
N-[2-(4-chlorophenyl)ethyl]-4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 3680294) has the molecular formula C19H21Cl2N3O2S2 and a molecular weight of 458.44 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3680294 |
| Molecular Formula | C19H21Cl2N3O2S2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCN(C(=S)NCCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H21Cl2N3O2S2/c20-16-3-1-15(2-4-16)9-10-22-19(27)23-11-13-24(14-12-23)28(25,26)18-7-5-17(21)6-8-18/h1-8H,9-14H2,(H,22,27) |
| InChIKey | JZKJACKWRBWVMH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|