C22H28ClN3O2S2 — CID 3686007
N-(4-butyl-2-methylphenyl)-4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 3686007) has the molecular formula C22H28ClN3O2S2 and a molecular weight of 466.07 g/mol. Its IUPAC name is N-(4-butyl-2-methylphenyl)-4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(4-butyl-2-methylphenyl)-4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3686007 |
| Molecular Formula | C22H28ClN3O2S2 |
| Molecular Weight | 466.07 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-(4-butyl-2-methylphenyl)-4-(4-chlorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | CCCCc1ccc(NC(=S)N2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H28ClN3O2S2/c1-3-4-5-18-6-11-21(17(2)16-18)24-22(29)25-12-14-26(15-13-25)30(27,28)20-9-7-19(23)8-10-20/h6-11,16H,3-5,12-15H2,1-2H3,(H,24,29) |
| InChIKey | KGSOHHDETULSDI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.07 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|