C18H19ClFN3O2S2 — CID 19687985
N-(5-chloro-2-methylphenyl)-4-(4-fluorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 19687985) has the molecular formula C18H19ClFN3O2S2 and a molecular weight of 427.95 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-4-(4-fluorophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-4-(4-fluorophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19687985 |
| Molecular Formula | C18H19ClFN3O2S2 |
| Molecular Weight | 427.95 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-4-(4-fluorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | Cc1ccc(Cl)cc1NC(=S)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H19ClFN3O2S2/c1-13-2-3-14(19)12-17(13)21-18(26)22-8-10-23(11-9-22)27(24,25)16-6-4-15(20)5-7-16/h2-7,12H,8-11H2,1H3,(H,21,26) |
| InChIKey | UZMOKYHFPWTTDA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.95 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|