C12H15ClN2S — CID 19653628
N-(5-chloro-2-methylphenyl)pyrrolidine-1-carbothioamide (PubChem CID 19653628) has the molecular formula C12H15ClN2S and a molecular weight of 254.79 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)pyrrolidine-1-carbothioamide.
| Compound Name | N-(5-chloro-2-methylphenyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 19653628 |
| Molecular Formula | C12H15ClN2S |
| Molecular Weight | 254.79 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)pyrrolidine-1-carbothioamide |
| SMILES | Cc1ccc(Cl)cc1NC(=S)N1CCCC1 |
| InChI | InChI=1S/C12H15ClN2S/c1-9-4-5-10(13)8-11(9)14-12(16)15-6-2-3-7-15/h4-5,8H,2-3,6-7H2,1H3,(H,14,16) |
| InChIKey | VBAZMWKOKBKZCS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.79 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|