C20H24ClN3S — CID 17269939
N-(5-chloro-2-methylphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide (PubChem CID 17269939) has the molecular formula C20H24ClN3S and a molecular weight of 373.95 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17269939 |
| Molecular Formula | C20H24ClN3S |
| Molecular Weight | 373.95 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(N2CCN(C(=S)Nc3cc(Cl)ccc3C)CC2C)cc1 |
| InChI | InChI=1S/C20H24ClN3S/c1-14-4-8-18(9-5-14)24-11-10-23(13-16(24)3)20(25)22-19-12-17(21)7-6-15(19)2/h4-9,12,16H,10-11,13H2,1-3H3,(H,22,25) |
| InChIKey | NEQWAILWICVKDT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.95 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|