C23H25N3S — CID 19655324
3-methyl-4-(4-methylphenyl)-N-naphthalen-1-ylpiperazine-1-carbothioamide (PubChem CID 19655324) has the molecular formula C23H25N3S and a molecular weight of 375.54 g/mol. Its IUPAC name is 3-methyl-4-(4-methylphenyl)-N-naphthalen-1-ylpiperazine-1-carbothioamide.
| Compound Name | 3-methyl-4-(4-methylphenyl)-N-naphthalen-1-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19655324 |
| Molecular Formula | C23H25N3S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3-methyl-4-(4-methylphenyl)-N-naphthalen-1-ylpiperazine-1-carbothioamide |
| SMILES | Cc1ccc(N2CCN(C(=S)Nc3cccc4ccccc34)CC2C)cc1 |
| InChI | InChI=1S/C23H25N3S/c1-17-10-12-20(13-11-17)26-15-14-25(16-18(26)2)23(27)24-22-9-5-7-19-6-3-4-8-21(19)22/h3-13,18H,14-16H2,1-2H3,(H,24,27) |
| InChIKey | ROCNZHXLZCPXOY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|