C25H27N3OS — CID 23991043
4-(4-methoxyphenyl)-3-methyl-N-(2-phenylphenyl)piperazine-1-carbothioamide (PubChem CID 23991043) has the molecular formula C25H27N3OS and a molecular weight of 417.58 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-methyl-N-(2-phenylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(4-methoxyphenyl)-3-methyl-N-(2-phenylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 23991043 |
| Molecular Formula | C25H27N3OS |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-methyl-N-(2-phenylphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(N2CCN(C(=S)Nc3ccccc3-c3ccccc3)CC2C)cc1 |
| InChI | InChI=1S/C25H27N3OS/c1-19-18-27(16-17-28(19)21-12-14-22(29-2)15-13-21)25(30)26-24-11-7-6-10-23(24)20-8-4-3-5-9-20/h3-15,19H,16-18H2,1-2H3,(H,26,30) |
| InChIKey | AMDWLQVSHPPEPD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|