C24H29N3OS — CID 3754158
4-(cyclohexanecarbonyl)-N-(2-phenylphenyl)piperazine-1-carbothioamide (PubChem CID 3754158) has the molecular formula C24H29N3OS and a molecular weight of 407.58 g/mol. Its IUPAC name is 4-(cyclohexanecarbonyl)-N-(2-phenylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(cyclohexanecarbonyl)-N-(2-phenylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3754158 |
| Molecular Formula | C24H29N3OS |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-(cyclohexanecarbonyl)-N-(2-phenylphenyl)piperazine-1-carbothioamide |
| SMILES | O=C(C1CCCCC1)N1CCN(C(=S)Nc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N3OS/c28-23(20-11-5-2-6-12-20)26-15-17-27(18-16-26)24(29)25-22-14-8-7-13-21(22)19-9-3-1-4-10-19/h1,3-4,7-10,13-14,20H,2,5-6,11-12,15-18H2,(H,25,29) |
| InChIKey | OBBIUHCJENIYCI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|