C24H24N2O — CID 1433497
(3R)-3-phenyl-N-(2-phenylphenyl)piperidine-1-carboxamide (PubChem CID 1433497) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is (3R)-3-phenyl-N-(2-phenylphenyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-phenyl-N-(2-phenylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 1433497 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (3R)-3-phenyl-N-(2-phenylphenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)N1CCC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C24H24N2O/c27-24(26-17-9-14-21(18-26)19-10-3-1-4-11-19)25-23-16-8-7-15-22(23)20-12-5-2-6-13-20/h1-8,10-13,15-16,21H,9,14,17-18H2,(H,25,27)/t21-/m0/s1 |
| InChIKey | UOGYRDQWAKJZHL-NRFANRHFSA-N |
| XLogP | 5.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |