C24H23N3O2 — CID 51687470
(2R)-1-N-phenyl-2-N-(2-phenylphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 51687470) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (2R)-1-N-phenyl-2-N-(2-phenylphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-phenyl-2-N-(2-phenylphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 51687470 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (2R)-1-N-phenyl-2-N-(2-phenylphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)[C@H]1CCCN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H23N3O2/c28-23(26-21-15-8-7-14-20(21)18-10-3-1-4-11-18)22-16-9-17-27(22)24(29)25-19-12-5-2-6-13-19/h1-8,10-15,22H,9,16-17H2,(H,25,29)(H,26,28)/t22-/m1/s1 |
| InChIKey | GKFUFGDUKWITAF-JOCHJYFZSA-N |
| XLogP | 4.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |