C18H18FN3O2 — CID 1445832
(2R)-1-N-(4-fluorophenyl)-2-N-phenylpyrrolidine-1,2-dicarboxamide (PubChem CID 1445832) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is (2R)-1-N-(4-fluorophenyl)-2-N-phenylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-(4-fluorophenyl)-2-N-phenylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1445832 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (2R)-1-N-(4-fluorophenyl)-2-N-phenylpyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)[C@H]1CCCN1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FN3O2/c19-13-8-10-15(11-9-13)21-18(24)22-12-4-7-16(22)17(23)20-14-5-2-1-3-6-14/h1-3,5-6,8-11,16H,4,7,12H2,(H,20,23)(H,21,24)/t16-/m1/s1 |
| InChIKey | GXBVQNIKPHCYQJ-MRXNPFEDSA-N |
| XLogP | 3.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |