C20H21NO3 — CID 8019936
[2-oxo-2-(2-phenylanilino)ethyl] cyclopentanecarboxylate (PubChem CID 8019936) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylanilino)ethyl] cyclopentanecarboxylate.
| Compound Name | [2-oxo-2-(2-phenylanilino)ethyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 8019936 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | [2-oxo-2-(2-phenylanilino)ethyl] cyclopentanecarboxylate |
| SMILES | O=C(COC(=O)C1CCCC1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H21NO3/c22-19(14-24-20(23)16-10-4-5-11-16)21-18-13-7-6-12-17(18)15-8-2-1-3-9-15/h1-3,6-9,12-13,16H,4-5,10-11,14H2,(H,21,22) |
| InChIKey | LGGBOCLJQLSWOL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |