C15H18ClNO3 — CID 2495206
[2-(2-chloroanilino)-2-oxoethyl] cyclohexanecarboxylate (PubChem CID 2495206) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl] cyclohexanecarboxylate.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 2495206 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl] cyclohexanecarboxylate |
| SMILES | O=C(COC(=O)C1CCCCC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H18ClNO3/c16-12-8-4-5-9-13(12)17-14(18)10-20-15(19)11-6-2-1-3-7-11/h4-5,8-9,11H,1-3,6-7,10H2,(H,17,18) |
| InChIKey | ICYBEPHXXQFRPK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |