C15H19NO4 — CID 2364845
[2-(2-Methoxyanilino)-2-oxoethyl] cyclopentanecarboxylate (PubChem CID 2364845) has the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] cyclopentanecarboxylate.
| Compound Name | [2-(2-Methoxyanilino)-2-oxoethyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 2364845 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] cyclopentanecarboxylate |
| SMILES | COC1=CC=CC=C1NC(=O)COC(=O)C2CCCC2 |
| InChI | InChI=1S/C15H19NO4/c1-19-13-9-5-4-8-12(13)16-14(17)10-20-15(18)11-6-2-3-7-11/h4-5,8-9,11H,2-3,6-7,10H2,1H3,(H,16,17) |
| InChIKey | OXOWJQVHRLNVSU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 339 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |