C21H22N2O4 — CID 8020094
[2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl] cyclopentanecarboxylate (PubChem CID 8020094) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is [2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl] cyclopentanecarboxylate.
| Compound Name | [2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 8020094 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl] cyclopentanecarboxylate |
| SMILES | O=C(COC(=O)C1CCCC1)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H22N2O4/c24-19(14-27-21(26)15-8-4-5-9-15)23-18-13-7-6-12-17(18)20(25)22-16-10-2-1-3-11-16/h1-3,6-7,10-13,15H,4-5,8-9,14H2,(H,22,25)(H,23,24) |
| InChIKey | GRJRJHBNDVOJOY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |