C13H13Cl2NO3 — CID 8019688
[2-(2,6-dichloroanilino)-2-oxoethyl] cyclobutanecarboxylate (PubChem CID 8019688) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] cyclobutanecarboxylate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 8019688 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] cyclobutanecarboxylate |
| SMILES | O=C(COC(=O)C1CCC1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H13Cl2NO3/c14-9-5-2-6-10(15)12(9)16-11(17)7-19-13(18)8-3-1-4-8/h2,5-6,8H,1,3-4,7H2,(H,16,17) |
| InChIKey | SXKPZOIYBZQITI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |