C19H21Cl2NO3 — CID 8518626
[2-(2,6-dichloroanilino)-2-oxoethyl] adamantane-2-carboxylate (PubChem CID 8518626) has the molecular formula C19H21Cl2NO3 and a molecular weight of 382.29 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] adamantane-2-carboxylate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8518626 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] adamantane-2-carboxylate |
| SMILES | O=C(COC(=O)C1C2CC3CC(C2)CC1C3)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H21Cl2NO3/c20-14-2-1-3-15(21)18(14)22-16(23)9-25-19(24)17-12-5-10-4-11(7-12)8-13(17)6-10/h1-3,10-13,17H,4-9H2,(H,22,23) |
| InChIKey | HVQIYPDVPYURRE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |