C18H22Cl2N2O — CID 7536783
2-(1-adamantylamino)-N-(2,6-dichlorophenyl)acetamide (PubChem CID 7536783) has the molecular formula C18H22Cl2N2O and a molecular weight of 353.29 g/mol. Its IUPAC name is 2-(1-adamantylamino)-N-(2,6-dichlorophenyl)acetamide.
| Compound Name | 2-(1-adamantylamino)-N-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7536783 |
| Molecular Formula | C18H22Cl2N2O |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-(1-adamantylamino)-N-(2,6-dichlorophenyl)acetamide |
| SMILES | O=C(CNC12CC3CC(CC(C3)C1)C2)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H22Cl2N2O/c19-14-2-1-3-15(20)17(14)22-16(23)10-21-18-7-11-4-12(8-18)6-13(5-11)9-18/h1-3,11-13,21H,4-10H2,(H,22,23) |
| InChIKey | MBSWNGXLLVOWJS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |