C20H27ClN2O — CID 7666468
2-(1-adamantylamino)-N-(2-chloro-4,6-dimethylphenyl)acetamide (PubChem CID 7666468) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is 2-(1-adamantylamino)-N-(2-chloro-4,6-dimethylphenyl)acetamide.
| Compound Name | 2-(1-adamantylamino)-N-(2-chloro-4,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 7666468 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-(1-adamantylamino)-N-(2-chloro-4,6-dimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC23CC4CC(CC(C4)C2)C3)c(Cl)c1 |
| InChI | InChI=1S/C20H27ClN2O/c1-12-3-13(2)19(17(21)4-12)23-18(24)11-22-20-8-14-5-15(9-20)7-16(6-14)10-20/h3-4,14-16,22H,5-11H2,1-2H3,(H,23,24) |
| InChIKey | QUTATPYQATXGHX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |