C19H23Cl2NO — CID 98385692
(5R,7R)-3-chloro-N-(2-chloro-4,6-dimethylphenyl)adamantane-1-carboxamide (PubChem CID 98385692) has the molecular formula C19H23Cl2NO and a molecular weight of 352.31 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-(2-chloro-4,6-dimethylphenyl)adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-(2-chloro-4,6-dimethylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98385692 |
| Molecular Formula | C19H23Cl2NO |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (5R,7R)-3-chloro-N-(2-chloro-4,6-dimethylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C23C[C@H]4C[C@@H](CC(Cl)(C4)C2)C3)c(Cl)c1 |
| InChI | InChI=1S/C19H23Cl2NO/c1-11-3-12(2)16(15(20)4-11)22-17(23)18-6-13-5-14(7-18)9-19(21,8-13)10-18/h3-4,13-14H,5-10H2,1-2H3,(H,22,23)/t13-,14-,18?,19?/m1/s1 |
| InChIKey | HJGXKWUBWBSNBX-CXTCDGGRSA-N |
| XLogP | 5.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|