C18H22ClNO3S — CID 98349263
(5R,7R)-3-chloro-N-(4-methylsulfonylphenyl)adamantane-1-carboxamide (PubChem CID 98349263) has the molecular formula C18H22ClNO3S and a molecular weight of 367.90 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-(4-methylsulfonylphenyl)adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-(4-methylsulfonylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98349263 |
| Molecular Formula | C18H22ClNO3S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (5R,7R)-3-chloro-N-(4-methylsulfonylphenyl)adamantane-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)C23C[C@H]4C[C@@H](CC(Cl)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H22ClNO3S/c1-24(22,23)15-4-2-14(3-5-15)20-16(21)17-7-12-6-13(8-17)10-18(19,9-12)11-17/h2-5,12-13H,6-11H2,1H3,(H,20,21)/t12-,13-,17?,18?/m1/s1 |
| InChIKey | BXPXWHKQCSNBNO-LGBHXNNWSA-N |
| XLogP | 3.61 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|