C15H20ClN3O — CID 98159930
(5R,7R)-3-chloro-N-(1-methylpyrazol-3-yl)adamantane-1-carboxamide (PubChem CID 98159930) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-(1-methylpyrazol-3-yl)adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-(1-methylpyrazol-3-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98159930 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (5R,7R)-3-chloro-N-(1-methylpyrazol-3-yl)adamantane-1-carboxamide |
| SMILES | Cn1ccc(NC(=O)C23C[C@H]4C[C@@H](CC(Cl)(C4)C2)C3)n1 |
| InChI | InChI=1S/C15H20ClN3O/c1-19-3-2-12(18-19)17-13(20)14-5-10-4-11(6-14)8-15(16,7-10)9-14/h2-3,10-11H,4-9H2,1H3,(H,17,18,20)/t10-,11-,14?,15?/m1/s1 |
| InChIKey | OQPWZEIRKWIHEW-ASNHAOSHSA-N |
| XLogP | 2.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|