C19H24ClNO — CID 7916897
(5S,7R)-3-chloro-N-[(4-methylphenyl)methyl]adamantane-1-carboxamide (PubChem CID 7916897) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-[(4-methylphenyl)methyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-[(4-methylphenyl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7916897 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (5S,7R)-3-chloro-N-[(4-methylphenyl)methyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H24ClNO/c1-13-2-4-14(5-3-13)11-21-17(22)18-7-15-6-16(8-18)10-19(20,9-15)12-18/h2-5,15-16H,6-12H2,1H3,(H,21,22)/t15-,16+,18?,19? |
| InChIKey | NFKNUOVIBNKZBN-CCZBSFLLSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|