C20H24ClFN2O2 — CID 9393302
(5S,7R)-3-chloro-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 9393302) has the molecular formula C20H24ClFN2O2 and a molecular weight of 378.88 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9393302 |
| Molecular Formula | C20H24ClFN2O2 |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (5S,7R)-3-chloro-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | O=C(CNC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H24ClFN2O2/c21-20-8-14-5-15(9-20)7-19(6-14,12-20)18(26)24-11-17(25)23-10-13-1-3-16(22)4-2-13/h1-4,14-15H,5-12H2,(H,23,25)(H,24,26)/t14-,15+,19?,20? |
| InChIKey | SVTKLMWLWSQVHM-JNKARSBBSA-N |
| XLogP | 3.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|