C17H26ClN3O3 — CID 23350801
(5S,7S)-3-chloro-N-[2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 23350801) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is (5S,7S)-3-chloro-N-[2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | (5S,7S)-3-chloro-N-[2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 23350801 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (5S,7S)-3-chloro-N-[2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | CN(C)C(=O)CNC(=O)CNC(=O)C12C[C@@H]3C[C@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C17H26ClN3O3/c1-21(2)14(23)9-19-13(22)8-20-15(24)16-4-11-3-12(5-16)7-17(18,6-11)10-16/h11-12H,3-10H2,1-2H3,(H,19,22)(H,20,24)/t11-,12-,16?,17?/m0/s1 |
| InChIKey | VHFQXVHRJAQBTK-MQAIEQDTSA-N |
| XLogP | 0.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|