C20H26ClN3O4 — CID 7600751
(5S,7R)-3-chloro-N-[2-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 7600751) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-[2-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-[2-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7600751 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (5S,7R)-3-chloro-N-[2-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | Cc1cc(C(=O)NNC(=O)CNC(=O)C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)c(C)o1 |
| InChI | InChI=1S/C20H26ClN3O4/c1-11-3-15(12(2)28-11)17(26)24-23-16(25)9-22-18(27)19-5-13-4-14(6-19)8-20(21,7-13)10-19/h3,13-14H,4-10H2,1-2H3,(H,22,27)(H,23,25)(H,24,26)/t13-,14+,19?,20? |
| InChIKey | CIAGLZKKCBJVET-LWYUSKRHSA-N |
| XLogP | 2.35 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|