C18H21ClFNO — CID 98368951
(5R,7R)-3-chloro-N-[(4-fluorophenyl)methyl]adamantane-1-carboxamide (PubChem CID 98368951) has the molecular formula C18H21ClFNO and a molecular weight of 321.82 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-[(4-fluorophenyl)methyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-[(4-fluorophenyl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98368951 |
| Molecular Formula | C18H21ClFNO |
| Molecular Weight | 321.82 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (5R,7R)-3-chloro-N-[(4-fluorophenyl)methyl]adamantane-1-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C18H21ClFNO/c19-18-8-13-5-14(9-18)7-17(6-13,11-18)16(22)21-10-12-1-3-15(20)4-2-12/h1-4,13-14H,5-11H2,(H,21,22)/t13-,14-,17?,18?/m1/s1 |
| InChIKey | KMLMNRMJROFQLD-JDPPGYRCSA-N |
| XLogP | 4.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.82 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|