C17H18Cl2FNO — CID 8759479
(5S,7R)-3-chloro-N-(5-chloro-2-fluorophenyl)adamantane-1-carboxamide (PubChem CID 8759479) has the molecular formula C17H18Cl2FNO and a molecular weight of 342.24 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-(5-chloro-2-fluorophenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-(5-chloro-2-fluorophenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 8759479 |
| Molecular Formula | C17H18Cl2FNO |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | (5S,7R)-3-chloro-N-(5-chloro-2-fluorophenyl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1F)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C17H18Cl2FNO/c18-12-1-2-13(20)14(4-12)21-15(22)16-5-10-3-11(6-16)8-17(19,7-10)9-16/h1-2,4,10-11H,3,5-9H2,(H,21,22)/t10-,11+,16?,17? |
| InChIKey | DNUBINSMFUUBTH-HLASGMPESA-N |
| XLogP | 5.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|