C18H21BrFNO3S — CID 55369511
3-bromo-N-(2-fluoro-5-methylsulfonylphenyl)adamantane-1-carboxamide (PubChem CID 55369511) has the molecular formula C18H21BrFNO3S and a molecular weight of 430.34 g/mol. Its IUPAC name is 3-bromo-N-(2-fluoro-5-methylsulfonylphenyl)adamantane-1-carboxamide.
| Compound Name | 3-bromo-N-(2-fluoro-5-methylsulfonylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 55369511 |
| Molecular Formula | C18H21BrFNO3S |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 3-bromo-N-(2-fluoro-5-methylsulfonylphenyl)adamantane-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(F)c(NC(=O)C23CC4CC(CC(Br)(C4)C2)C3)c1 |
| InChI | InChI=1S/C18H21BrFNO3S/c1-25(23,24)13-2-3-14(20)15(5-13)21-16(22)17-6-11-4-12(7-17)9-18(19,8-11)10-17/h2-3,5,11-12H,4,6-10H2,1H3,(H,21,22) |
| InChIKey | YMIBNCFEWQNGDY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|