C18H21BrClNO — CID 55342373
3-bromo-N-(2-chloro-4-methylphenyl)adamantane-1-carboxamide (PubChem CID 55342373) has the molecular formula C18H21BrClNO and a molecular weight of 382.73 g/mol. Its IUPAC name is 3-bromo-N-(2-chloro-4-methylphenyl)adamantane-1-carboxamide.
| Compound Name | 3-bromo-N-(2-chloro-4-methylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 55342373 |
| Molecular Formula | C18H21BrClNO |
| Molecular Weight | 382.73 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 3-bromo-N-(2-chloro-4-methylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C23CC4CC(CC(Br)(C4)C2)C3)c(Cl)c1 |
| InChI | InChI=1S/C18H21BrClNO/c1-11-2-3-15(14(20)4-11)21-16(22)17-6-12-5-13(7-17)9-18(19,8-12)10-17/h2-4,12-13H,5-10H2,1H3,(H,21,22) |
| InChIKey | AGNNXOZFDAVHQW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.73 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|