C21H26BrNO4 — CID 98401636
[2-(2-methoxy-5-methylanilino)-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 98401636) has the molecular formula C21H26BrNO4 and a molecular weight of 436.35 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98401636 |
| Molecular Formula | C21H26BrNO4 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | COc1ccc(C)cc1NC(=O)COC(=O)C12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C21H26BrNO4/c1-13-3-4-17(26-2)16(5-13)23-18(24)11-27-19(25)20-7-14-6-15(8-20)10-21(22,9-14)12-20/h3-5,14-15H,6-12H2,1-2H3,(H,23,24)/t14-,15-,20?,21?/m1/s1 |
| InChIKey | KWUZBEAWBUKVQL-VKFLQFAXSA-N |
| XLogP | 4.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|