C22H28BrNO5 — CID 98306449
[2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 98306449) has the molecular formula C22H28BrNO5 and a molecular weight of 466.37 g/mol. Its IUPAC name is [2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98306449 |
| Molecular Formula | C22H28BrNO5 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | [2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | COc1ccc(CNC(=O)COC(=O)C23C[C@H]4C[C@@H](CC(Br)(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C22H28BrNO5/c1-27-17-4-3-14(6-18(17)28-2)11-24-19(25)12-29-20(26)21-7-15-5-16(8-21)10-22(23,9-15)13-21/h3-4,6,15-16H,5,7-13H2,1-2H3,(H,24,25)/t15-,16-,21?,22?/m1/s1 |
| InChIKey | IBZWXUKTZFIXAZ-KILAXVPQSA-N |
| XLogP | 3.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|