C22H30BrNO3 — CID 55632666
3-bromo-N-[(3-methoxy-4-propoxyphenyl)methyl]adamantane-1-carboxamide (PubChem CID 55632666) has the molecular formula C22H30BrNO3 and a molecular weight of 436.39 g/mol. Its IUPAC name is 3-bromo-N-[(3-methoxy-4-propoxyphenyl)methyl]adamantane-1-carboxamide.
| Compound Name | 3-bromo-N-[(3-methoxy-4-propoxyphenyl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 55632666 |
| Molecular Formula | C22H30BrNO3 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 3-bromo-N-[(3-methoxy-4-propoxyphenyl)methyl]adamantane-1-carboxamide |
| SMILES | CCCOc1ccc(CNC(=O)C23CC4CC(CC(Br)(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C22H30BrNO3/c1-3-6-27-18-5-4-15(8-19(18)26-2)13-24-20(25)21-9-16-7-17(10-21)12-22(23,11-16)14-21/h4-5,8,16-17H,3,6-7,9-14H2,1-2H3,(H,24,25) |
| InChIKey | YWLHKOIWMBBGNU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|