C18H22BrNO — CID 2384610
(5S,7R)-N-benzyl-3-bromoadamantane-1-carboxamide (PubChem CID 2384610) has the molecular formula C18H22BrNO and a molecular weight of 348.28 g/mol. Its IUPAC name is (5S,7R)-N-benzyl-3-bromoadamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-benzyl-3-bromoadamantane-1-carboxamide |
|---|---|
| PubChem CID | 2384610 |
| Molecular Formula | C18H22BrNO |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (5S,7R)-N-benzyl-3-bromoadamantane-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C18H22BrNO/c19-18-9-14-6-15(10-18)8-17(7-14,12-18)16(21)20-11-13-4-2-1-3-5-13/h1-5,14-15H,6-12H2,(H,20,21)/t14-,15+,17?,18? |
| InChIKey | SLYIFTMFXFYPBW-BXXOZEPKSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|