C20H27BrN2O3S — CID 55795509
N-[2-(benzylsulfamoyl)ethyl]-3-bromoadamantane-1-carboxamide (PubChem CID 55795509) has the molecular formula C20H27BrN2O3S and a molecular weight of 455.42 g/mol. Its IUPAC name is N-[2-(benzylsulfamoyl)ethyl]-3-bromoadamantane-1-carboxamide.
| Compound Name | N-[2-(benzylsulfamoyl)ethyl]-3-bromoadamantane-1-carboxamide |
|---|---|
| PubChem CID | 55795509 |
| Molecular Formula | C20H27BrN2O3S |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-[2-(benzylsulfamoyl)ethyl]-3-bromoadamantane-1-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)NCc1ccccc1)C12CC3CC(CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C20H27BrN2O3S/c21-20-11-16-8-17(12-20)10-19(9-16,14-20)18(24)22-6-7-27(25,26)23-13-15-4-2-1-3-5-15/h1-5,16-17,23H,6-14H2,(H,22,24) |
| InChIKey | XZRGTWQIACBYOW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|