C19H25BrN2O3S — CID 98392780
(5R,7R)-3-bromo-N-[2-(4-sulfamoylphenyl)ethyl]adamantane-1-carboxamide (PubChem CID 98392780) has the molecular formula C19H25BrN2O3S and a molecular weight of 441.39 g/mol. Its IUPAC name is (5R,7R)-3-bromo-N-[2-(4-sulfamoylphenyl)ethyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-bromo-N-[2-(4-sulfamoylphenyl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98392780 |
| Molecular Formula | C19H25BrN2O3S |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (5R,7R)-3-bromo-N-[2-(4-sulfamoylphenyl)ethyl]adamantane-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)C23C[C@H]4C[C@@H](CC(Br)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H25BrN2O3S/c20-19-10-14-7-15(11-19)9-18(8-14,12-19)17(23)22-6-5-13-1-3-16(4-2-13)26(21,24)25/h1-4,14-15H,5-12H2,(H,22,23)(H2,21,24,25)/t14-,15-,18?,19?/m1/s1 |
| InChIKey | RUJZODVPSYMBAB-QAQJPARQSA-N |
| XLogP | 2.73 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|