C13H16Cl2N2O3S — CID 46651331
2,2-dichloro-1-methyl-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1-carboxamide (PubChem CID 46651331) has the molecular formula C13H16Cl2N2O3S and a molecular weight of 351.26 g/mol. Its IUPAC name is 2,2-dichloro-1-methyl-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-methyl-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46651331 |
| Molecular Formula | C13H16Cl2N2O3S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2,2-dichloro-1-methyl-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C13H16Cl2N2O3S/c1-12(8-13(12,14)15)11(18)17-7-6-9-2-4-10(5-3-9)21(16,19)20/h2-5H,6-8H2,1H3,(H,17,18)(H2,16,19,20) |
| InChIKey | DMPFLNFRZGVGCA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|