C13H14Cl3NO — CID 2229042
(1S)-2,2-dichloro-N-[2-(4-chlorophenyl)ethyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 2229042) has the molecular formula C13H14Cl3NO and a molecular weight of 306.62 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-[2-(4-chlorophenyl)ethyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-[2-(4-chlorophenyl)ethyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2229042 |
| Molecular Formula | C13H14Cl3NO |
| Molecular Weight | 306.62 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | (1S)-2,2-dichloro-N-[2-(4-chlorophenyl)ethyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@@]1(C(=O)NCCc2ccc(Cl)cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C13H14Cl3NO/c1-12(8-13(12,15)16)11(18)17-7-6-9-2-4-10(14)5-3-9/h2-5H,6-8H2,1H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | JNTGQMZVYRQNPW-LBPRGKRZSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|