C17H19Cl3N2O — CID 22082561
N-[2-(4-chlorophenyl)ethyl]-2-cyano-3-[(1R)-2,2-dichloro-1-methylcyclopropyl]butanamide (PubChem CID 22082561) has the molecular formula C17H19Cl3N2O and a molecular weight of 373.71 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-cyano-3-[(1R)-2,2-dichloro-1-methylcyclopropyl]butanamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-cyano-3-[(1R)-2,2-dichloro-1-methylcyclopropyl]butanamide |
|---|---|
| PubChem CID | 22082561 |
| Molecular Formula | C17H19Cl3N2O |
| Molecular Weight | 373.71 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-cyano-3-[(1R)-2,2-dichloro-1-methylcyclopropyl]butanamide |
| SMILES | CC(C(C#N)C(=O)NCCc1ccc(Cl)cc1)[C@@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C17H19Cl3N2O/c1-11(16(2)10-17(16,19)20)14(9-21)15(23)22-8-7-12-3-5-13(18)6-4-12/h3-6,11,14H,7-8,10H2,1-2H3,(H,22,23)/t11?,14?,16-/m1/s1 |
| InChIKey | RJWHDVUVBKITAF-HFLCMSJXSA-N |
| XLogP | 4.36 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.71 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|