C12H12ClN3O2 — CID 61380619
N-[2-(4-chlorophenyl)ethyl]-N'-(cyanomethyl)oxamide (PubChem CID 61380619) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-N'-(cyanomethyl)oxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-N'-(cyanomethyl)oxamide |
|---|---|
| PubChem CID | 61380619 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-N'-(cyanomethyl)oxamide |
| SMILES | N#CCNC(=O)C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClN3O2/c13-10-3-1-9(2-4-10)5-7-15-11(17)12(18)16-8-6-14/h1-4H,5,7-8H2,(H,15,17)(H,16,18) |
| InChIKey | YFEYXKRVUKXVPD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|