C15H21ClN2O3 — CID 125144861
N'-[2-(4-chlorophenyl)ethyl]-N-(3-ethoxypropyl)oxamide (PubChem CID 125144861) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)ethyl]-N-(3-ethoxypropyl)oxamide.
| Compound Name | N'-[2-(4-chlorophenyl)ethyl]-N-(3-ethoxypropyl)oxamide |
|---|---|
| PubChem CID | 125144861 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N'-[2-(4-chlorophenyl)ethyl]-N-(3-ethoxypropyl)oxamide |
| SMILES | CCOCCCNC(=O)C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-2-21-11-3-9-17-14(19)15(20)18-10-8-12-4-6-13(16)7-5-12/h4-7H,2-3,8-11H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | ANHRJOKPFLDHGB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|