C16H24ClN3O2 — CID 17171276
4-(4-chlorophenyl)-N-(3-ethoxypropyl)piperazine-1-carboxamide (PubChem CID 17171276) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(3-ethoxypropyl)piperazine-1-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-(3-ethoxypropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 17171276 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(3-ethoxypropyl)piperazine-1-carboxamide |
| SMILES | CCOCCCNC(=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H24ClN3O2/c1-2-22-13-3-8-18-16(21)20-11-9-19(10-12-20)15-6-4-14(17)5-7-15/h4-7H,2-3,8-13H2,1H3,(H,18,21) |
| InChIKey | NSJFSAZKUFVISE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|